C19H19N3O3 — CID 51643283
(4S)-5,8-dimethoxy-2-quinazolin-4-yl-3,4-dihydro-1H-isoquinolin-4-ol (PubChem CID 51643283) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is (4S)-5,8-dimethoxy-2-quinazolin-4-yl-3,4-dihydro-1H-isoquinolin-4-ol.
| Compound Name | (4S)-5,8-dimethoxy-2-quinazolin-4-yl-3,4-dihydro-1H-isoquinolin-4-ol |
|---|---|
| PubChem CID | 51643283 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (4S)-5,8-dimethoxy-2-quinazolin-4-yl-3,4-dihydro-1H-isoquinolin-4-ol |
| SMILES | COc1ccc(OC)c2c1CN(c1ncnc3ccccc13)C[C@H]2O |
| InChI | InChI=1S/C19H19N3O3/c1-24-16-7-8-17(25-2)18-13(16)9-22(10-15(18)23)19-12-5-3-4-6-14(12)20-11-21-19/h3-8,11,15,23H,9-10H2,1-2H3/t15-/m1/s1 |
| InChIKey | HBEUZBIIUNVPRQ-OAHLLOKOSA-N |
| XLogP | 2.70 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |