About dichlorocopper;bis(pyridine)
dichlorocopper;bis(pyridine) (PubChem CID 5164376) has the molecular formula C10H10Cl2CuN2
and a molecular weight of 292.66 g/mol. Its IUPAC name is dichlorocopper;bis(pyridine).
Molecular Properties
| Compound Name | dichlorocopper;bis(pyridine) |
| PubChem CID | 5164376 |
| Molecular Formula | C10H10Cl2CuN2 |
| Molecular Weight | 292.66 g/mol |
| Exact Mass | 290.95 |
| IUPAC Name | dichlorocopper;bis(pyridine) |
| SMILES | Cl[Cu]Cl.c1ccncc1.c1ccncc1 |
| InChI | InChI=1S/2C5H5N.2ClH.Cu/c2*1-2-4-6-5-3-1;;;/h2*1-5H;2*1H;/q;;;;+2/p-2 |
| InChIKey | UBNQPNIJAJFCJK-UHFFFAOYSA-L |
| XLogP | 3.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.66 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichlorocopper;bis(pyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocopper;bis(pyridine)?
The IUPAC name of dichlorocopper;bis(pyridine) (CID 5164376) is dichlorocopper;bis(pyridine).
What is the SMILES notation for dichlorocopper;bis(pyridine)?
The canonical SMILES for dichlorocopper;bis(pyridine) is Cl[Cu]Cl.c1ccncc1.c1ccncc1.
What is the InChIKey of dichlorocopper;bis(pyridine)?
The InChIKey is UBNQPNIJAJFCJK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H5N.2ClH.Cu/c2*1-2-4-6-5-3-1;;;/h2*1-5H;2*1H;/q;;;;+2/p-2.
What are the key properties of dichlorocopper;bis(pyridine)?
dichlorocopper;bis(pyridine) has a molecular weight of 292.66 g/mol, XLogP of 3.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocopper;bis(pyridine) is sourced from PubChem (CID 5164376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).