C22H19F2NO2 — CID 51645271
(2R)-2-(2,4-difluorophenoxy)-N-(2,5-dimethylphenyl)-2-phenylacetamide (PubChem CID 51645271) has the molecular formula C22H19F2NO2 and a molecular weight of 367.40 g/mol. Its IUPAC name is (2R)-2-(2,4-difluorophenoxy)-N-(2,5-dimethylphenyl)-2-phenylacetamide.
| Compound Name | (2R)-2-(2,4-difluorophenoxy)-N-(2,5-dimethylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 51645271 |
| Molecular Formula | C22H19F2NO2 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2R)-2-(2,4-difluorophenoxy)-N-(2,5-dimethylphenyl)-2-phenylacetamide |
| SMILES | Cc1ccc(C)c(NC(=O)[C@H](Oc2ccc(F)cc2F)c2ccccc2)c1 |
| InChI | InChI=1S/C22H19F2NO2/c1-14-8-9-15(2)19(12-14)25-22(26)21(16-6-4-3-5-7-16)27-20-11-10-17(23)13-18(20)24/h3-13,21H,1-2H3,(H,25,26)/t21-/m1/s1 |
| InChIKey | GKQIFCKOZCKENR-OAQYLSRUSA-N |
| XLogP | 5.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |