About 3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one
3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one (PubChem CID 516457) has the molecular formula C23H25NO
and a molecular weight of 331.46 g/mol. Its IUPAC name is 3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one.
Molecular Properties
| Compound Name | 3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one |
| PubChem CID | 516457 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one |
| SMILES | CCc1ccc2c(c1)-c1c(c(=O)c3ccc(C(C)C)cc3n1CC)C2 |
| InChI | InChI=1S/C23H25NO/c1-5-15-7-8-17-12-20-22(19(17)11-15)24(6-2)21-13-16(14(3)4)9-10-18(21)23(20)25/h7-11,13-14H,5-6,12H2,1-4H3 |
| InChIKey | ZBWLZBRVXVAMPP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one?
The IUPAC name of 3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one (CID 516457) is 3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one.
What is the SMILES notation for 3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one?
The canonical SMILES for 3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one is CCc1ccc2c(c1)-c1c(c(=O)c3ccc(C(C)C)cc3n1CC)C2.
What is the InChIKey of 3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one?
The InChIKey is ZBWLZBRVXVAMPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO/c1-5-15-7-8-17-12-20-22(19(17)11-15)24(6-2)21-13-16(14(3)4)9-10-18(21)23(20)25/h7-11,13-14H,5-6,12H2,1-4H3.
What are the key properties of 3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one?
3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one has a molecular weight of 331.46 g/mol, XLogP of 5.28, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-7-propan-2-yl-11H-indeno[1,2-b]quinolin-10-one is sourced from PubChem (CID 516457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).