C22H20N4O2 — CID 51649138
3-[(3R)-3-(1H-benzimidazol-2-yl)piperidine-1-carbonyl]-2H-isoquinolin-1-one (PubChem CID 51649138) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 3-[(3R)-3-(1H-benzimidazol-2-yl)piperidine-1-carbonyl]-2H-isoquinolin-1-one.
| Compound Name | 3-[(3R)-3-(1H-benzimidazol-2-yl)piperidine-1-carbonyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 51649138 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3-[(3R)-3-(1H-benzimidazol-2-yl)piperidine-1-carbonyl]-2H-isoquinolin-1-one |
| SMILES | O=C(c1cc2ccccc2c(=O)[nH]1)N1CCC[C@@H](c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C22H20N4O2/c27-21-16-8-2-1-6-14(16)12-19(25-21)22(28)26-11-5-7-15(13-26)20-23-17-9-3-4-10-18(17)24-20/h1-4,6,8-10,12,15H,5,7,11,13H2,(H,23,24)(H,25,27)/t15-/m1/s1 |
| InChIKey | QYLNFIHQFFOVKD-OAHLLOKOSA-N |
| XLogP | 3.42 |
| TPSA | 81.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |