About 2-methylidenepentanoic acid
2-methylidenepentanoic acid (PubChem CID 5165043) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is 2-methylidenepentanoic acid.
Molecular Properties
| Compound Name | 2-methylidenepentanoic acid |
| PubChem CID | 5165043 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 2-methylidenepentanoic acid |
| SMILES | C=C(CCC)C(=O)O |
| InChI | InChI=1S/C6H10O2/c1-3-4-5(2)6(7)8/h2-4H2,1H3,(H,7,8) |
| InChIKey | HEBDGRTWECSNNT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenepentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenepentanoic acid?
The IUPAC name of 2-methylidenepentanoic acid (CID 5165043) is 2-methylidenepentanoic acid.
What is the SMILES notation for 2-methylidenepentanoic acid?
The canonical SMILES for 2-methylidenepentanoic acid is C=C(CCC)C(=O)O.
What is the InChIKey of 2-methylidenepentanoic acid?
The InChIKey is HEBDGRTWECSNNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2/c1-3-4-5(2)6(7)8/h2-4H2,1H3,(H,7,8).
What are the key properties of 2-methylidenepentanoic acid?
2-methylidenepentanoic acid has a molecular weight of 114.14 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenepentanoic acid is sourced from PubChem (CID 5165043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).