About (7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one
(7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one (PubChem CID 51651317) has the molecular formula C14H11Cl3O6
and a molecular weight of 381.60 g/mol. Its IUPAC name is (7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one.
Molecular Properties
| Compound Name | (7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one |
| PubChem CID | 51651317 |
| Molecular Formula | C14H11Cl3O6 |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | (7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one |
| SMILES | COc1c2c(c(OC)c3occc13)O[C@@](O)(C(Cl)(Cl)Cl)CC2=O |
| InChI | InChI=1S/C14H11Cl3O6/c1-20-9-6-3-4-22-10(6)12(21-2)11-8(9)7(18)5-13(19,23-11)14(15,16)17/h3-4,19H,5H2,1-2H3/t13-/m1/s1 |
| InChIKey | QONHLGXPMCLQRD-CYBMUJFWSA-N |
| XLogP | 3.47 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one?
The IUPAC name of (7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one (CID 51651317) is (7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one.
What is the SMILES notation for (7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one?
The canonical SMILES for (7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one is COc1c2c(c(OC)c3occc13)O[C@@](O)(C(Cl)(Cl)Cl)CC2=O.
What is the InChIKey of (7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one?
The InChIKey is QONHLGXPMCLQRD-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H11Cl3O6/c1-20-9-6-3-4-22-10(6)12(21-2)11-8(9)7(18)5-13(19,23-11)14(15,16)17/h3-4,19H,5H2,1-2H3/t13-/m1/s1.
What are the key properties of (7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one?
(7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one has a molecular weight of 381.60 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-7-hydroxy-4,9-dimethoxy-7-(trichloromethyl)-6H-furo[3,2-g]chromen-5-one is sourced from PubChem (CID 51651317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).