About 9H-xanthen-9-ylazanium
9H-xanthen-9-ylazanium (PubChem CID 51652356) has the molecular formula C13H12NO+
and a molecular weight of 198.25 g/mol. Its IUPAC name is 9H-xanthen-9-ylazanium.
Molecular Properties
| Compound Name | 9H-xanthen-9-ylazanium |
| PubChem CID | 51652356 |
| Molecular Formula | C13H12NO+ |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 9H-xanthen-9-ylazanium |
| SMILES | [NH3+]C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C13H11NO/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,13H,14H2/p+1 |
| InChIKey | OTTYHRLXKGOXLY-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9H-xanthen-9-ylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-xanthen-9-ylazanium?
The IUPAC name of 9H-xanthen-9-ylazanium (CID 51652356) is 9H-xanthen-9-ylazanium.
What is the SMILES notation for 9H-xanthen-9-ylazanium?
The canonical SMILES for 9H-xanthen-9-ylazanium is [NH3+]C1c2ccccc2Oc2ccccc21.
What is the InChIKey of 9H-xanthen-9-ylazanium?
The InChIKey is OTTYHRLXKGOXLY-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H11NO/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,13H,14H2/p+1.
What are the key properties of 9H-xanthen-9-ylazanium?
9H-xanthen-9-ylazanium has a molecular weight of 198.25 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-xanthen-9-ylazanium is sourced from PubChem (CID 51652356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).