C18H17IN2O — CID 51653679
(2R,5S,6R)-4-(4-iodophenyl)-6-(4-methoxyphenyl)-2-methyl-1,3-diazabicyclo[3.1.0]hex-3-ene (PubChem CID 51653679) has the molecular formula C18H17IN2O and a molecular weight of 404.25 g/mol. Its IUPAC name is (2R,5S,6R)-4-(4-iodophenyl)-6-(4-methoxyphenyl)-2-methyl-1,3-diazabicyclo[3.1.0]hex-3-ene.
| Compound Name | (2R,5S,6R)-4-(4-iodophenyl)-6-(4-methoxyphenyl)-2-methyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
|---|---|
| PubChem CID | 51653679 |
| Molecular Formula | C18H17IN2O |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | (2R,5S,6R)-4-(4-iodophenyl)-6-(4-methoxyphenyl)-2-methyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
| SMILES | COc1ccc([C@@H]2[C@H]3C(c4ccc(I)cc4)=N[C@H](C)N32)cc1 |
| InChI | InChI=1S/C18H17IN2O/c1-11-20-16(12-3-7-14(19)8-4-12)18-17(21(11)18)13-5-9-15(22-2)10-6-13/h3-11,17-18H,1-2H3/t11-,17+,18+,21?/m0/s1 |
| InChIKey | YLVOOGAXYLZBPG-LDHDRURFSA-N |
| XLogP | 3.87 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|