About S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate
S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate (PubChem CID 516555) has the molecular formula C11H20N2O3S2
and a molecular weight of 292.43 g/mol. Its IUPAC name is S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate.
Molecular Properties
| Compound Name | S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate |
| PubChem CID | 516555 |
| Molecular Formula | C11H20N2O3S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate |
| SMILES | CC(=O)N[C@@H](CS)C(=O)NCCSC(=O)C(C)C |
| InChI | InChI=1S/C11H20N2O3S2/c1-7(2)11(16)18-5-4-12-10(15)9(6-17)13-8(3)14/h7,9,17H,4-6H2,1-3H3,(H,12,15)(H,13,14)/t9-/m0/s1 |
| InChIKey | BHPQLUJLEGGJCF-VIFPVBQESA-N |
| XLogP | 0.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate?
The IUPAC name of S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate (CID 516555) is S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate.
What is the SMILES notation for S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate?
The canonical SMILES for S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate is CC(=O)N[C@@H](CS)C(=O)NCCSC(=O)C(C)C.
What is the InChIKey of S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate?
The InChIKey is BHPQLUJLEGGJCF-VIFPVBQESA-N. The full InChI is InChI=1S/C11H20N2O3S2/c1-7(2)11(16)18-5-4-12-10(15)9(6-17)13-8(3)14/h7,9,17H,4-6H2,1-3H3,(H,12,15)(H,13,14)/t9-/m0/s1.
What are the key properties of S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate?
S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate has a molecular weight of 292.43 g/mol, XLogP of 0.45, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate is sourced from PubChem (CID 516555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).