About S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate
S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate (PubChem CID 516556) has the molecular formula C12H22N2O3S2
and a molecular weight of 306.45 g/mol. Its IUPAC name is S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate.
Molecular Properties
| Compound Name | S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate |
| PubChem CID | 516556 |
| Molecular Formula | C12H22N2O3S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(=O)N[C@@H](CS)C(=O)NCCSC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H22N2O3S2/c1-8(15)14-9(7-18)10(16)13-5-6-19-11(17)12(2,3)4/h9,18H,5-7H2,1-4H3,(H,13,16)(H,14,15)/t9-/m0/s1 |
| InChIKey | RJQQUWMMKDXXLV-VIFPVBQESA-N |
| XLogP | 0.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate?
The IUPAC name of S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate (CID 516556) is S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate.
What is the SMILES notation for S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate?
The canonical SMILES for S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate is CC(=O)N[C@@H](CS)C(=O)NCCSC(=O)C(C)(C)C.
What is the InChIKey of S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate?
The InChIKey is RJQQUWMMKDXXLV-VIFPVBQESA-N. The full InChI is InChI=1S/C12H22N2O3S2/c1-8(15)14-9(7-18)10(16)13-5-6-19-11(17)12(2,3)4/h9,18H,5-7H2,1-4H3,(H,13,16)(H,14,15)/t9-/m0/s1.
What are the key properties of S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate?
S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate has a molecular weight of 306.45 g/mol, XLogP of 0.84, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]ethyl] 2,2-dimethylpropanethioate is sourced from PubChem (CID 516556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).