About S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate
S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate (PubChem CID 516560) has the molecular formula C14H24N2O4S2
and a molecular weight of 348.49 g/mol. Its IUPAC name is S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate.
Molecular Properties
| Compound Name | S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate |
| PubChem CID | 516560 |
| Molecular Formula | C14H24N2O4S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate |
| SMILES | CC(=O)N[C@@H](CSC(=O)C(C)(C)C)C(=O)NCCSC(C)=O |
| InChI | InChI=1S/C14H24N2O4S2/c1-9(17)16-11(8-22-13(20)14(3,4)5)12(19)15-6-7-21-10(2)18/h11H,6-8H2,1-5H3,(H,15,19)(H,16,17)/t11-/m0/s1 |
| InChIKey | MOCFOHYIQSCVIP-NSHDSACASA-N |
| XLogP | 1.19 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate?
The IUPAC name of S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate (CID 516560) is S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate.
What is the SMILES notation for S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate?
The canonical SMILES for S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate is CC(=O)N[C@@H](CSC(=O)C(C)(C)C)C(=O)NCCSC(C)=O.
What is the InChIKey of S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate?
The InChIKey is MOCFOHYIQSCVIP-NSHDSACASA-N. The full InChI is InChI=1S/C14H24N2O4S2/c1-9(17)16-11(8-22-13(20)14(3,4)5)12(19)15-6-7-21-10(2)18/h11H,6-8H2,1-5H3,(H,15,19)(H,16,17)/t11-/m0/s1.
What are the key properties of S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate?
S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate has a molecular weight of 348.49 g/mol, XLogP of 1.19, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2R)-2-acetamido-3-(2-acetylsulfanylethylamino)-3-oxopropyl] 2,2-dimethylpropanethioate is sourced from PubChem (CID 516560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).