About (3S)-3-methyl-2,3-dihydrothiochromen-4-one
(3S)-3-methyl-2,3-dihydrothiochromen-4-one (PubChem CID 51656328) has the molecular formula C10H10OS
and a molecular weight of 178.26 g/mol. Its IUPAC name is (3S)-3-methyl-2,3-dihydrothiochromen-4-one.
Molecular Properties
| Compound Name | (3S)-3-methyl-2,3-dihydrothiochromen-4-one |
| PubChem CID | 51656328 |
| Molecular Formula | C10H10OS |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (3S)-3-methyl-2,3-dihydrothiochromen-4-one |
| SMILES | C[C@@H]1CSc2ccccc2C1=O |
| InChI | InChI=1S/C10H10OS/c1-7-6-12-9-5-3-2-4-8(9)10(7)11/h2-5,7H,6H2,1H3/t7-/m1/s1 |
| InChIKey | XCJJYQRFPYKZAU-SSDOTTSWSA-N |
| XLogP | 2.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-methyl-2,3-dihydrothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methyl-2,3-dihydrothiochromen-4-one?
The IUPAC name of (3S)-3-methyl-2,3-dihydrothiochromen-4-one (CID 51656328) is (3S)-3-methyl-2,3-dihydrothiochromen-4-one.
What is the SMILES notation for (3S)-3-methyl-2,3-dihydrothiochromen-4-one?
The canonical SMILES for (3S)-3-methyl-2,3-dihydrothiochromen-4-one is C[C@@H]1CSc2ccccc2C1=O.
What is the InChIKey of (3S)-3-methyl-2,3-dihydrothiochromen-4-one?
The InChIKey is XCJJYQRFPYKZAU-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H10OS/c1-7-6-12-9-5-3-2-4-8(9)10(7)11/h2-5,7H,6H2,1H3/t7-/m1/s1.
What are the key properties of (3S)-3-methyl-2,3-dihydrothiochromen-4-one?
(3S)-3-methyl-2,3-dihydrothiochromen-4-one has a molecular weight of 178.26 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methyl-2,3-dihydrothiochromen-4-one is sourced from PubChem (CID 51656328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).