C11H6ClF2N5S — CID 5165902
3-[chloro(difluoro)methyl]-6-pyridin-2-ylsulfanyl-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 5165902) has the molecular formula C11H6ClF2N5S and a molecular weight of 313.72 g/mol. Its IUPAC name is 3-[chloro(difluoro)methyl]-6-pyridin-2-ylsulfanyl-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-[chloro(difluoro)methyl]-6-pyridin-2-ylsulfanyl-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 5165902 |
| Molecular Formula | C11H6ClF2N5S |
| Molecular Weight | 313.72 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 3-[chloro(difluoro)methyl]-6-pyridin-2-ylsulfanyl-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | FC(F)(Cl)c1nnc2ccc(Sc3ccccn3)nn12 |
| InChI | InChI=1S/C11H6ClF2N5S/c12-11(13,14)10-17-16-7-4-5-9(18-19(7)10)20-8-3-1-2-6-15-8/h1-6H |
| InChIKey | PRQISCITYFZMIS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.72 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|