2-{[(Tert-butoxy)carbonyl]amino}pent-4-enoic acid

C10H17NO4 — CID 5166119

IUPAC2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid
SMILESCC(C)(C)OC(=O)NC(CC=C)C(=O)O
InChIInChI=1S/C10H17NO4/c1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h5,7H,1,6H2,2-4H3,(H,11,14)(H,12,13)
InChIKeyBUPDPLXLAKNJMI-UHFFFAOYSA-N
MW215.25 g/mol
LogP1.70
Rot. Bonds6

About 2-{[(Tert-butoxy)carbonyl]amino}pent-4-enoic acid

2-{[(Tert-butoxy)carbonyl]amino}pent-4-enoic acid (PubChem CID 5166119) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid.

Molecular Properties

Compound Name2-{[(Tert-butoxy)carbonyl]amino}pent-4-enoic acid
PubChem CID5166119
Molecular FormulaC10H17NO4
Molecular Weight215.25 g/mol
Exact Mass215.12
IUPAC Name2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid
SMILESCC(C)(C)OC(=O)NC(CC=C)C(=O)O
InChIInChI=1S/C10H17NO4/c1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h5,7H,1,6H2,2-4H3,(H,11,14)(H,12,13)
InChIKeyBUPDPLXLAKNJMI-UHFFFAOYSA-N
XLogP1.70
TPSA75.60 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity255

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.25
LogP ≤ 51.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-{[(Tert-butoxy)carbonyl]amino}pent-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-{[(Tert-butoxy)carbonyl]amino}pent-4-enoic acid?
The IUPAC name of 2-{[(Tert-butoxy)carbonyl]amino}pent-4-enoic acid (CID 5166119) is 2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid.
What is the SMILES notation for 2-{[(Tert-butoxy)carbonyl]amino}pent-4-enoic acid?
The canonical SMILES for 2-{[(Tert-butoxy)carbonyl]amino}pent-4-enoic acid is CC(C)(C)OC(=O)NC(CC=C)C(=O)O.
What is the InChIKey of 2-{[(Tert-butoxy)carbonyl]amino}pent-4-enoic acid?
The InChIKey is BUPDPLXLAKNJMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4/c1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h5,7H,1,6H2,2-4H3,(H,11,14)(H,12,13).
What are the key properties of 2-{[(Tert-butoxy)carbonyl]amino}pent-4-enoic acid?
2-{[(Tert-butoxy)carbonyl]amino}pent-4-enoic acid has a molecular weight of 215.25 g/mol, XLogP of 1.70, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-{[(Tert-butoxy)carbonyl]amino}pent-4-enoic acid is sourced from PubChem (CID 5166119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).