About 3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine
3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine (PubChem CID 516614) has the molecular formula C16H10N4
and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine.
Molecular Properties
| Compound Name | 3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine |
| PubChem CID | 516614 |
| Molecular Formula | C16H10N4 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine |
| SMILES | c1ccc2cc(-c3nnc4ccncc4n3)ccc2c1 |
| InChI | InChI=1S/C16H10N4/c1-2-4-12-9-13(6-5-11(12)3-1)16-18-15-10-17-8-7-14(15)19-20-16/h1-10H |
| InChIKey | XNJVTIPYRKIRNL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine?
The IUPAC name of 3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine (CID 516614) is 3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine.
What is the SMILES notation for 3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine?
The canonical SMILES for 3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine is c1ccc2cc(-c3nnc4ccncc4n3)ccc2c1.
What is the InChIKey of 3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine?
The InChIKey is XNJVTIPYRKIRNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N4/c1-2-4-12-9-13(6-5-11(12)3-1)16-18-15-10-17-8-7-14(15)19-20-16/h1-10H.
What are the key properties of 3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine?
3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine has a molecular weight of 258.28 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-naphthalen-2-ylpyrido[3,4-e][1,2,4]triazine is sourced from PubChem (CID 516614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).