About 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine
1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine (PubChem CID 5166291) has the molecular formula C21H18N10
and a molecular weight of 410.44 g/mol. Its IUPAC name is 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine.
Molecular Properties
| Compound Name | 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine |
| PubChem CID | 5166291 |
| Molecular Formula | C21H18N10 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine |
| SMILES | c1ccc2c(c1)nnn2CN(Cn1nnc2ccccc21)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C21H18N10/c1-4-10-19-16(7-1)22-25-29(19)13-28(14-30-20-11-5-2-8-17(20)23-26-30)15-31-21-12-6-3-9-18(21)24-27-31/h1-12H,13-15H2 |
| InChIKey | CGTJPXSHORTCPU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine?
The IUPAC name of 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine (CID 5166291) is 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine.
What is the SMILES notation for 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine?
The canonical SMILES for 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine is c1ccc2c(c1)nnn2CN(Cn1nnc2ccccc21)Cn1nnc2ccccc21.
What is the InChIKey of 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine?
The InChIKey is CGTJPXSHORTCPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N10/c1-4-10-19-16(7-1)22-25-29(19)13-28(14-30-20-11-5-2-8-17(20)23-26-30)15-31-21-12-6-3-9-18(21)24-27-31/h1-12H,13-15H2.
What are the key properties of 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine?
1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine has a molecular weight of 410.44 g/mol, XLogP of 2.50, 6 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzotriazol-1-yl)-N,N-bis(benzotriazol-1-ylmethyl)methanamine is sourced from PubChem (CID 5166291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).