C19H14Cl2N4O — CID 51663119
(4R,4aR)-2-amino-4-(3,5-dichloro-2-hydroxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 51663119) has the molecular formula C19H14Cl2N4O and a molecular weight of 385.25 g/mol. Its IUPAC name is (4R,4aR)-2-amino-4-(3,5-dichloro-2-hydroxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4R,4aR)-2-amino-4-(3,5-dichloro-2-hydroxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 51663119 |
| Molecular Formula | C19H14Cl2N4O |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | (4R,4aR)-2-amino-4-(3,5-dichloro-2-hydroxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@H](c2cc(Cl)cc(Cl)c2O)[C@H]2CCCC=C12 |
| InChI | InChI=1S/C19H14Cl2N4O/c20-10-5-13(17(26)15(21)6-10)16-12-4-2-1-3-11(12)14(7-22)18(25)19(16,8-23)9-24/h3,5-6,12,16,26H,1-2,4,25H2/t12-,16-/m0/s1 |
| InChIKey | QYBDWRGNKJKQKH-LRDDRELGSA-N |
| XLogP | 4.29 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|