C19H17IN2O3S — CID 5166367
[2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 2-iodobenzoate (PubChem CID 5166367) has the molecular formula C19H17IN2O3S and a molecular weight of 480.33 g/mol. Its IUPAC name is [2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 2-iodobenzoate.
| Compound Name | [2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 5166367 |
| Molecular Formula | C19H17IN2O3S |
| Molecular Weight | 480.33 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | [2-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] 2-iodobenzoate |
| SMILES | CC1CCc2c(sc(NC(=O)COC(=O)c3ccccc3I)c2C#N)C1 |
| InChI | InChI=1S/C19H17IN2O3S/c1-11-6-7-12-14(9-21)18(26-16(12)8-11)22-17(23)10-25-19(24)13-4-2-3-5-15(13)20/h2-5,11H,6-8,10H2,1H3,(H,22,23) |
| InChIKey | WPQSUABIZFOCPF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|