C11H13ClO2 — CID 51663755
(2S)-2-(2,3-dimethylphenoxy)propanoyl chloride (PubChem CID 51663755) has the molecular formula C11H13ClO2 and a molecular weight of 212.68 g/mol. Its IUPAC name is (2S)-2-(2,3-dimethylphenoxy)propanoyl chloride.
| Compound Name | (2S)-2-(2,3-dimethylphenoxy)propanoyl chloride |
|---|---|
| PubChem CID | 51663755 |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | (2S)-2-(2,3-dimethylphenoxy)propanoyl chloride |
| SMILES | Cc1cccc(O[C@@H](C)C(=O)Cl)c1C |
| InChI | InChI=1S/C11H13ClO2/c1-7-5-4-6-10(8(7)2)14-9(3)11(12)13/h4-6,9H,1-3H3/t9-/m0/s1 |
| InChIKey | PNHRNLFAIOSJMU-VIFPVBQESA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|