C18H19FN2O4S3 — CID 51664311
(2S)-N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(5E)-5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-methylpropanamide (PubChem CID 51664311) has the molecular formula C18H19FN2O4S3 and a molecular weight of 442.56 g/mol. Its IUPAC name is (2S)-N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(5E)-5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-methylpropanamide.
| Compound Name | (2S)-N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(5E)-5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 51664311 |
| Molecular Formula | C18H19FN2O4S3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | (2S)-N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(5E)-5-[(2-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-methylpropanamide |
| SMILES | C[C@@H](C(=O)N(C)[C@@H]1CCS(=O)(=O)C1)N1C(=O)/C(=C\c2ccccc2F)SC1=S |
| InChI | InChI=1S/C18H19FN2O4S3/c1-11(16(22)20(2)13-7-8-28(24,25)10-13)21-17(23)15(27-18(21)26)9-12-5-3-4-6-14(12)19/h3-6,9,11,13H,7-8,10H2,1-2H3/b15-9+/t11-,13+/m0/s1 |
| InChIKey | VIMCYODAGUHURN-VBTYFWCOSA-N |
| XLogP | 2.06 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|