C32H31N3O4 — CID 51664977
(3S,4R)-N-[4-(dimethylamino)phenyl]-2,3-bis(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 51664977) has the molecular formula C32H31N3O4 and a molecular weight of 521.62 g/mol. Its IUPAC name is (3S,4R)-N-[4-(dimethylamino)phenyl]-2,3-bis(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3S,4R)-N-[4-(dimethylamino)phenyl]-2,3-bis(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 51664977 |
| Molecular Formula | C32H31N3O4 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | (3S,4R)-N-[4-(dimethylamino)phenyl]-2,3-bis(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | COc1ccc([C@@H]2[C@H](C(=O)Nc3ccc(N(C)C)cc3)c3ccccc3C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H31N3O4/c1-34(2)23-13-11-22(12-14-23)33-31(36)29-27-7-5-6-8-28(27)32(37)35(24-15-19-26(39-4)20-16-24)30(29)21-9-17-25(38-3)18-10-21/h5-20,29-30H,1-4H3,(H,33,36)/t29-,30-/m1/s1 |
| InChIKey | ADKVWRLCUMUBTH-LOYHVIPDSA-N |
| XLogP | 5.89 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|