C22H33NO7 — CID 516652
1-(benzylamino)-3-[[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol (PubChem CID 516652) has the molecular formula C22H33NO7 and a molecular weight of 423.51 g/mol. Its IUPAC name is 1-(benzylamino)-3-[[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol.
| Compound Name | 1-(benzylamino)-3-[[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol |
|---|---|
| PubChem CID | 516652 |
| Molecular Formula | C22H33NO7 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 1-(benzylamino)-3-[[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol |
| SMILES | CC1(C)O[C@H]2OC(COCC(O)CNCc3ccccc3)[C@@H]3OC(C)(C)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C22H33NO7/c1-21(2)27-17-16(26-20-19(18(17)28-21)29-22(3,4)30-20)13-25-12-15(24)11-23-10-14-8-6-5-7-9-14/h5-9,15-20,23-24H,10-13H2,1-4H3/t15?,16?,17-,18-,19+,20+/m0/s1 |
| InChIKey | NTLCCVYGPOYMEB-JGECRLCUSA-N |
| XLogP | 1.55 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |