C17H21N5 — CID 51667336
(8S,8aR)-6-amino-8-ethyl-2-propyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 51667336) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is (8S,8aR)-6-amino-8-ethyl-2-propyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8S,8aR)-6-amino-8-ethyl-2-propyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 51667336 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (8S,8aR)-6-amino-8-ethyl-2-propyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | CCCN1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@@H](CC)[C@H]2C1 |
| InChI | InChI=1S/C17H21N5/c1-3-6-22-7-5-12-13(8-18)16(21)17(10-19,11-20)15(4-2)14(12)9-22/h5,14-15H,3-4,6-7,9,21H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | VAQRVCBBEULQPJ-GJZGRUSLSA-N |
| XLogP | 2.06 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|