C22H23ClFNO5 — CID 51667413
3-O-ethyl 6-O-methyl (4S,6R,7R)-4-(2-chloro-6-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 51667413) has the molecular formula C22H23ClFNO5 and a molecular weight of 435.88 g/mol. Its IUPAC name is 3-O-ethyl 6-O-methyl (4S,6R,7R)-4-(2-chloro-6-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-ethyl 6-O-methyl (4S,6R,7R)-4-(2-chloro-6-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51667413 |
| Molecular Formula | C22H23ClFNO5 |
| Molecular Weight | 435.88 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 3-O-ethyl 6-O-methyl (4S,6R,7R)-4-(2-chloro-6-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)[C@H](C(=O)OC)[C@H](C)C2)[C@@H]1c1c(F)cccc1Cl |
| InChI | InChI=1S/C22H23ClFNO5/c1-5-30-22(28)16-11(3)25-14-9-10(2)15(21(27)29-4)20(26)18(14)19(16)17-12(23)7-6-8-13(17)24/h6-8,10,15,19,25H,5,9H2,1-4H3/t10-,15-,19+/m1/s1 |
| InChIKey | LCDCXQRBGZMGFG-KRNUTZAJSA-N |
| XLogP | 3.66 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.88 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|