C27H68Si8 — CID 5166829
trimethyl-[[3,4,5,6-tetrakis(trimethylsilyl)cyclohexen-1-yl]-bis(trimethylsilyl)silyl]silane (PubChem CID 5166829) has the molecular formula C27H68Si8 and a molecular weight of 617.53 g/mol. Its IUPAC name is trimethyl-[[3,4,5,6-tetrakis(trimethylsilyl)cyclohexen-1-yl]-bis(trimethylsilyl)silyl]silane.
| Compound Name | trimethyl-[[3,4,5,6-tetrakis(trimethylsilyl)cyclohexen-1-yl]-bis(trimethylsilyl)silyl]silane |
|---|---|
| PubChem CID | 5166829 |
| Molecular Formula | C27H68Si8 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 616.35 |
| IUPAC Name | trimethyl-[[3,4,5,6-tetrakis(trimethylsilyl)cyclohexen-1-yl]-bis(trimethylsilyl)silyl]silane |
| SMILES | C[Si](C)(C)C1C=C([Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)C([Si](C)(C)C)C([Si](C)(C)C)C1[Si](C)(C)C |
| InChI | InChI=1S/C27H68Si8/c1-28(2,3)23-22-24(35(32(13,14)15,33(16,17)18)34(19,20)21)26(30(7,8)9)27(31(10,11)12)25(23)29(4,5)6/h22-23,25-27H,1-21H3 |
| InChIKey | OYSKRAUWYPEHBC-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|