About (2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one
(2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one (PubChem CID 51669378) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is (2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one.
Molecular Properties
| Compound Name | (2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one |
| PubChem CID | 51669378 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | (2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one |
| SMILES | O=C1CCC[C@@H]1Cn1cncn1 |
| InChI | InChI=1S/C8H11N3O/c12-8-3-1-2-7(8)4-11-6-9-5-10-11/h5-7H,1-4H2/t7-/m1/s1 |
| InChIKey | GPRWMSVIDJJDLK-SSDOTTSWSA-N |
| XLogP | 0.65 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one?
The IUPAC name of (2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one (CID 51669378) is (2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one.
What is the SMILES notation for (2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one?
The canonical SMILES for (2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one is O=C1CCC[C@@H]1Cn1cncn1.
What is the InChIKey of (2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one?
The InChIKey is GPRWMSVIDJJDLK-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H11N3O/c12-8-3-1-2-7(8)4-11-6-9-5-10-11/h5-7H,1-4H2/t7-/m1/s1.
What are the key properties of (2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one?
(2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one has a molecular weight of 165.20 g/mol, XLogP of 0.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-one is sourced from PubChem (CID 51669378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).