C24H34N2O2 — CID 5167023
1-cycloheptyl-4-cyclohexyl-3-(4-methylphenyl)piperazine-2,5-dione (PubChem CID 5167023) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-cycloheptyl-4-cyclohexyl-3-(4-methylphenyl)piperazine-2,5-dione.
| Compound Name | 1-cycloheptyl-4-cyclohexyl-3-(4-methylphenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 5167023 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 1-cycloheptyl-4-cyclohexyl-3-(4-methylphenyl)piperazine-2,5-dione |
| SMILES | Cc1ccc(C2C(=O)N(C3CCCCCC3)CC(=O)N2C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H34N2O2/c1-18-13-15-19(16-14-18)23-24(28)25(20-9-5-2-3-6-10-20)17-22(27)26(23)21-11-7-4-8-12-21/h13-16,20-21,23H,2-12,17H2,1H3 |
| InChIKey | HGFMHNKSUCJKKT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |