C14H21IN2O2 — CID 5167039
5-iodo-N-(2,2,6,6-tetramethylpiperidin-4-yl)furan-2-carboxamide (PubChem CID 5167039) has the molecular formula C14H21IN2O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is 5-iodo-N-(2,2,6,6-tetramethylpiperidin-4-yl)furan-2-carboxamide.
| Compound Name | 5-iodo-N-(2,2,6,6-tetramethylpiperidin-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 5167039 |
| Molecular Formula | C14H21IN2O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 5-iodo-N-(2,2,6,6-tetramethylpiperidin-4-yl)furan-2-carboxamide |
| SMILES | CC1(C)CC(NC(=O)c2ccc(I)o2)CC(C)(C)N1 |
| InChI | InChI=1S/C14H21IN2O2/c1-13(2)7-9(8-14(3,4)17-13)16-12(18)10-5-6-11(15)19-10/h5-6,9,17H,7-8H2,1-4H3,(H,16,18) |
| InChIKey | SBYHBILJLKPJEG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|