About (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine
(2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine (PubChem CID 51670774) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine.
Molecular Properties
| Compound Name | (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine |
| PubChem CID | 51670774 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine |
| SMILES | C[C@H]1CN([C@@H](C)CN)C[C@H](C)O1 |
| InChI | InChI=1S/C9H20N2O/c1-7(4-10)11-5-8(2)12-9(3)6-11/h7-9H,4-6,10H2,1-3H3/t7-,8-,9-/m0/s1 |
| InChIKey | RNSSMMIAROTMLD-CIUDSAMLSA-N |
| XLogP | 0.44 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine?
The IUPAC name of (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine (CID 51670774) is (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine.
What is the SMILES notation for (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine?
The canonical SMILES for (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine is C[C@H]1CN([C@@H](C)CN)C[C@H](C)O1.
What is the InChIKey of (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine?
The InChIKey is RNSSMMIAROTMLD-CIUDSAMLSA-N. The full InChI is InChI=1S/C9H20N2O/c1-7(4-10)11-5-8(2)12-9(3)6-11/h7-9H,4-6,10H2,1-3H3/t7-,8-,9-/m0/s1.
What are the key properties of (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine?
(2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine has a molecular weight of 172.27 g/mol, XLogP of 0.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propan-1-amine is sourced from PubChem (CID 51670774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).