About (2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine
(2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine (PubChem CID 51672171) has the molecular formula C14H17N3O
and a molecular weight of 243.31 g/mol. Its IUPAC name is (2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine.
Molecular Properties
| Compound Name | (2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine |
| PubChem CID | 51672171 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | (2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine |
| SMILES | C[C@@H]1CN(c2ncnc3ccccc23)[C@H](C)CO1 |
| InChI | InChI=1S/C14H17N3O/c1-10-8-18-11(2)7-17(10)14-12-5-3-4-6-13(12)15-9-16-14/h3-6,9-11H,7-8H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | AWSDCGJYXVSDQE-GHMZBOCLSA-N |
| XLogP | 2.24 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine?
The IUPAC name of (2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine (CID 51672171) is (2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine.
What is the SMILES notation for (2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine?
The canonical SMILES for (2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine is C[C@@H]1CN(c2ncnc3ccccc23)[C@H](C)CO1.
What is the InChIKey of (2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine?
The InChIKey is AWSDCGJYXVSDQE-GHMZBOCLSA-N. The full InChI is InChI=1S/C14H17N3O/c1-10-8-18-11(2)7-17(10)14-12-5-3-4-6-13(12)15-9-16-14/h3-6,9-11H,7-8H2,1-2H3/t10-,11-/m1/s1.
What are the key properties of (2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine?
(2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine has a molecular weight of 243.31 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-2,5-dimethyl-4-quinazolin-4-ylmorpholine is sourced from PubChem (CID 51672171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).