About 5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one
5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one (PubChem CID 5167286) has the molecular formula C18H24N4O3
and a molecular weight of 344.41 g/mol. Its IUPAC name is 5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one.
Molecular Properties
| Compound Name | 5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one |
| PubChem CID | 5167286 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C18H24N4O3/c1-15-18(20-7-11-24-12-8-20,21-9-13-25-14-10-21)17(23)22(19-15)16-5-3-2-4-6-16/h2-6H,7-14H2,1H3 |
| InChIKey | XLPGEMTWLSUNBL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one?
The IUPAC name of 5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one (CID 5167286) is 5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one.
What is the SMILES notation for 5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one?
The canonical SMILES for 5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one is CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCOCC1.
What is the InChIKey of 5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one?
The InChIKey is XLPGEMTWLSUNBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O3/c1-15-18(20-7-11-24-12-8-20,21-9-13-25-14-10-21)17(23)22(19-15)16-5-3-2-4-6-16/h2-6H,7-14H2,1H3.
What are the key properties of 5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one?
5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one has a molecular weight of 344.41 g/mol, XLogP of 0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4,4-dimorpholin-4-yl-2-phenylpyrazol-3-one is sourced from PubChem (CID 5167286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).