About [(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol
[(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol (PubChem CID 51674883) has the molecular formula C10H10FNO2
and a molecular weight of 195.19 g/mol. Its IUPAC name is [(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol.
Molecular Properties
| Compound Name | [(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol |
| PubChem CID | 51674883 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | [(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol |
| SMILES | OC[C@H]1CC(c2ccc(F)cc2)=NO1 |
| InChI | InChI=1S/C10H10FNO2/c11-8-3-1-7(2-4-8)10-5-9(6-13)14-12-10/h1-4,9,13H,5-6H2/t9-/m1/s1 |
| InChIKey | YPJOMXMBEWPWLL-SECBINFHSA-N |
| XLogP | 1.31 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol?
The IUPAC name of [(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol (CID 51674883) is [(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol.
What is the SMILES notation for [(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol?
The canonical SMILES for [(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol is OC[C@H]1CC(c2ccc(F)cc2)=NO1.
What is the InChIKey of [(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol?
The InChIKey is YPJOMXMBEWPWLL-SECBINFHSA-N. The full InChI is InChI=1S/C10H10FNO2/c11-8-3-1-7(2-4-8)10-5-9(6-13)14-12-10/h1-4,9,13H,5-6H2/t9-/m1/s1.
What are the key properties of [(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol?
[(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol has a molecular weight of 195.19 g/mol, XLogP of 1.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol is sourced from PubChem (CID 51674883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).