C20H31NO4 — CID 51680135
ethyl (3R)-1-[(2S)-2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]piperidine-3-carboxylate (PubChem CID 51680135) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is ethyl (3R)-1-[(2S)-2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(2S)-2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 51680135 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | ethyl (3R)-1-[(2S)-2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C[C@H](O)COc2ccccc2C(C)C)C1 |
| InChI | InChI=1S/C20H31NO4/c1-4-24-20(23)16-8-7-11-21(12-16)13-17(22)14-25-19-10-6-5-9-18(19)15(2)3/h5-6,9-10,15-17,22H,4,7-8,11-14H2,1-3H3/t16-,17+/m1/s1 |
| InChIKey | UUJWJBPJLSKMCI-SJORKVTESA-N |
| XLogP | 2.82 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |