C12H17NO5S — CID 51681253
(1S,6R)-6-[[(3S)-1,1-dioxothiolan-3-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 51681253) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is (1S,6R)-6-[[(3S)-1,1-dioxothiolan-3-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[[(3S)-1,1-dioxothiolan-3-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 51681253 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (1S,6R)-6-[[(3S)-1,1-dioxothiolan-3-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1C(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H17NO5S/c14-11(13-8-5-6-19(17,18)7-8)9-3-1-2-4-10(9)12(15)16/h1-2,8-10H,3-7H2,(H,13,14)(H,15,16)/t8-,9+,10-/m0/s1 |
| InChIKey | SISPNTRQQLNRHH-AEJSXWLSSA-N |
| XLogP | -0.04 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|