About methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate
methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate (PubChem CID 51681562) has the molecular formula C16H23NO3
and a molecular weight of 277.36 g/mol. Its IUPAC name is methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate |
| PubChem CID | 51681562 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H23NO3/c1-10(2)6-14(16(19)20-5)17-15(18)13-8-11(3)7-12(4)9-13/h7-10,14H,6H2,1-5H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | AFHZFBSTOMZPEW-CQSZACIVSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate?
The IUPAC name of methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate (CID 51681562) is methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate.
What is the SMILES notation for methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate?
The canonical SMILES for methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate is COC(=O)[C@@H](CC(C)C)NC(=O)c1cc(C)cc(C)c1.
What is the InChIKey of methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate?
The InChIKey is AFHZFBSTOMZPEW-CQSZACIVSA-N. The full InChI is InChI=1S/C16H23NO3/c1-10(2)6-14(16(19)20-5)17-15(18)13-8-11(3)7-12(4)9-13/h7-10,14H,6H2,1-5H3,(H,17,18)/t14-/m1/s1.
What are the key properties of methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate?
methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate has a molecular weight of 277.36 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[(3,5-dimethylbenzoyl)amino]-4-methylpentanoate is sourced from PubChem (CID 51681562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).