C12H18ClN3S — CID 51681854
4-[[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-chlorothiadiazole (PubChem CID 51681854) has the molecular formula C12H18ClN3S and a molecular weight of 271.82 g/mol. Its IUPAC name is 4-[[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-chlorothiadiazole.
| Compound Name | 4-[[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-chlorothiadiazole |
|---|---|
| PubChem CID | 51681854 |
| Molecular Formula | C12H18ClN3S |
| Molecular Weight | 271.82 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 4-[[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-chlorothiadiazole |
| SMILES | Clc1snnc1CN1CCC[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C12H18ClN3S/c13-12-10(14-15-17-12)8-16-7-3-5-9-4-1-2-6-11(9)16/h9,11H,1-8H2/t9-,11+/m0/s1 |
| InChIKey | AYVHRZQQPNWVBR-GXSJLCMTSA-N |
| XLogP | 3.35 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.82 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |