C20H14Cl2N4S2 — CID 51682030
(2R,3R,4S)-6-amino-2,4-bis(4-chlorophenyl)-3,5-dicyano-2,4-dihydrothiopyran-3-carbothioamide (PubChem CID 51682030) has the molecular formula C20H14Cl2N4S2 and a molecular weight of 445.40 g/mol. Its IUPAC name is (2R,3R,4S)-6-amino-2,4-bis(4-chlorophenyl)-3,5-dicyano-2,4-dihydrothiopyran-3-carbothioamide.
| Compound Name | (2R,3R,4S)-6-amino-2,4-bis(4-chlorophenyl)-3,5-dicyano-2,4-dihydrothiopyran-3-carbothioamide |
|---|---|
| PubChem CID | 51682030 |
| Molecular Formula | C20H14Cl2N4S2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | (2R,3R,4S)-6-amino-2,4-bis(4-chlorophenyl)-3,5-dicyano-2,4-dihydrothiopyran-3-carbothioamide |
| SMILES | N#CC1=C(N)S[C@H](c2ccc(Cl)cc2)[C@@](C#N)(C(N)=S)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14Cl2N4S2/c21-13-5-1-11(2-6-13)16-15(9-23)18(25)28-17(20(16,10-24)19(26)27)12-3-7-14(22)8-4-12/h1-8,16-17H,25H2,(H2,26,27)/t16-,17+,20-/m0/s1 |
| InChIKey | YCSVQCWWFNNSLM-QKLQHJQFSA-N |
| XLogP | 5.06 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|