C20H24N2O10 — CID 51682724
methyl (2S,3R,4R,5S)-3,4,5-triacetyloxy-2-(phenylcarbamoylamino)oxane-2-carboxylate (PubChem CID 51682724) has the molecular formula C20H24N2O10 and a molecular weight of 452.42 g/mol. Its IUPAC name is methyl (2S,3R,4R,5S)-3,4,5-triacetyloxy-2-(phenylcarbamoylamino)oxane-2-carboxylate.
| Compound Name | methyl (2S,3R,4R,5S)-3,4,5-triacetyloxy-2-(phenylcarbamoylamino)oxane-2-carboxylate |
|---|---|
| PubChem CID | 51682724 |
| Molecular Formula | C20H24N2O10 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | methyl (2S,3R,4R,5S)-3,4,5-triacetyloxy-2-(phenylcarbamoylamino)oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(NC(=O)Nc2ccccc2)OC[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H24N2O10/c1-11(23)30-15-10-29-20(18(26)28-4,17(32-13(3)25)16(15)31-12(2)24)22-19(27)21-14-8-6-5-7-9-14/h5-9,15-17H,10H2,1-4H3,(H2,21,22,27)/t15-,16+,17+,20-/m0/s1 |
| InChIKey | ASOOQLOXFFNXRN-XLSPSMHOSA-N |
| XLogP | 0.50 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|