C18H26N2 — CID 51683301
3-[[[(1S,2R)-2-tert-butylcyclohexyl]amino]methyl]benzonitrile (PubChem CID 51683301) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 3-[[[(1S,2R)-2-tert-butylcyclohexyl]amino]methyl]benzonitrile.
| Compound Name | 3-[[[(1S,2R)-2-tert-butylcyclohexyl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 51683301 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 3-[[[(1S,2R)-2-tert-butylcyclohexyl]amino]methyl]benzonitrile |
| SMILES | CC(C)(C)[C@H]1CCCC[C@@H]1NCc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H26N2/c1-18(2,3)16-9-4-5-10-17(16)20-13-15-8-6-7-14(11-15)12-19/h6-8,11,16-17,20H,4-5,9-10,13H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | WEUIHWIUBGYHOW-IRXDYDNUSA-N |
| XLogP | 4.25 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |