C16H26N2 — CID 51683369
(2S)-N-[(3-methylphenyl)methyl]-1-piperidin-1-ylpropan-2-amine (PubChem CID 51683369) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (2S)-N-[(3-methylphenyl)methyl]-1-piperidin-1-ylpropan-2-amine.
| Compound Name | (2S)-N-[(3-methylphenyl)methyl]-1-piperidin-1-ylpropan-2-amine |
|---|---|
| PubChem CID | 51683369 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (2S)-N-[(3-methylphenyl)methyl]-1-piperidin-1-ylpropan-2-amine |
| SMILES | Cc1cccc(CN[C@@H](C)CN2CCCCC2)c1 |
| InChI | InChI=1S/C16H26N2/c1-14-7-6-8-16(11-14)12-17-15(2)13-18-9-4-3-5-10-18/h6-8,11,15,17H,3-5,9-10,12-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | GZTPONIQMJPSRD-HNNXBMFYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |