C22H33NO6 — CID 51683755
[(5aR,9S,9aS,9bR)-9b-hydroxy-6,6,9a-trimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-9-yl] (2S)-2-acetamido-3-methylbutanoate (PubChem CID 51683755) has the molecular formula C22H33NO6 and a molecular weight of 407.51 g/mol. Its IUPAC name is [(5aR,9S,9aS,9bR)-9b-hydroxy-6,6,9a-trimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-9-yl] (2S)-2-acetamido-3-methylbutanoate.
| Compound Name | [(5aR,9S,9aS,9bR)-9b-hydroxy-6,6,9a-trimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-9-yl] (2S)-2-acetamido-3-methylbutanoate |
|---|---|
| PubChem CID | 51683755 |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | [(5aR,9S,9aS,9bR)-9b-hydroxy-6,6,9a-trimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-9-yl] (2S)-2-acetamido-3-methylbutanoate |
| SMILES | CC(=O)N[C@H](C(=O)O[C@H]1CCC(C)(C)[C@H]2CC=C3C(=O)OC[C@@]3(O)[C@]12C)C(C)C |
| InChI | InChI=1S/C22H33NO6/c1-12(2)17(23-13(3)24)19(26)29-16-9-10-20(4,5)15-8-7-14-18(25)28-11-22(14,27)21(15,16)6/h7,12,15-17,27H,8-11H2,1-6H3,(H,23,24)/t15-,16+,17+,21+,22+/m1/s1 |
| InChIKey | DFGYGTWTXGTQIC-WSKWMNRMSA-N |
| XLogP | 2.12 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |