C27H33N3O4S — CID 51687063
(1S)-N-(3-ethoxypropyl)-6,7-dimethoxy-1-(6-methyl-2-oxo-1H-quinolin-3-yl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 51687063) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is (1S)-N-(3-ethoxypropyl)-6,7-dimethoxy-1-(6-methyl-2-oxo-1H-quinolin-3-yl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | (1S)-N-(3-ethoxypropyl)-6,7-dimethoxy-1-(6-methyl-2-oxo-1H-quinolin-3-yl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 51687063 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | (1S)-N-(3-ethoxypropyl)-6,7-dimethoxy-1-(6-methyl-2-oxo-1H-quinolin-3-yl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | CCOCCCNC(=S)N1CCc2cc(OC)c(OC)cc2[C@H]1c1cc2cc(C)ccc2[nH]c1=O |
| InChI | InChI=1S/C27H33N3O4S/c1-5-34-12-6-10-28-27(35)30-11-9-18-15-23(32-3)24(33-4)16-20(18)25(30)21-14-19-13-17(2)7-8-22(19)29-26(21)31/h7-8,13-16,25H,5-6,9-12H2,1-4H3,(H,28,35)(H,29,31)/t25-/m0/s1 |
| InChIKey | IMWUHEBXADTGOV-VWLOTQADSA-N |
| XLogP | 4.10 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|