C19H19FN2O5 — CID 51687847
[(1R)-1-(2-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl] 4-methylfuro[3,2-b]pyrrole-5-carboxylate (PubChem CID 51687847) has the molecular formula C19H19FN2O5 and a molecular weight of 374.37 g/mol. Its IUPAC name is [(1R)-1-(2-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl] 4-methylfuro[3,2-b]pyrrole-5-carboxylate.
| Compound Name | [(1R)-1-(2-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl] 4-methylfuro[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 51687847 |
| Molecular Formula | C19H19FN2O5 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [(1R)-1-(2-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl] 4-methylfuro[3,2-b]pyrrole-5-carboxylate |
| SMILES | COCCNC(=O)[C@H](OC(=O)c1cc2occc2n1C)c1ccccc1F |
| InChI | InChI=1S/C19H19FN2O5/c1-22-14-7-9-26-16(14)11-15(22)19(24)27-17(18(23)21-8-10-25-2)12-5-3-4-6-13(12)20/h3-7,9,11,17H,8,10H2,1-2H3,(H,21,23)/t17-/m1/s1 |
| InChIKey | HFOQKNGWEJXVAD-QGZVFWFLSA-N |
| XLogP | 2.57 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|