C17H19N3O5S — CID 51688740
(7R)-7-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(ethylamino)-6,7-dihydro-4H-[1,3]thiazolo[4,5-b]pyridin-5-one (PubChem CID 51688740) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is (7R)-7-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(ethylamino)-6,7-dihydro-4H-[1,3]thiazolo[4,5-b]pyridin-5-one.
| Compound Name | (7R)-7-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(ethylamino)-6,7-dihydro-4H-[1,3]thiazolo[4,5-b]pyridin-5-one |
|---|---|
| PubChem CID | 51688740 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | (7R)-7-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(ethylamino)-6,7-dihydro-4H-[1,3]thiazolo[4,5-b]pyridin-5-one |
| SMILES | CCNc1nc2c(s1)[C@@H](c1cc3c(c(OC)c1OC)OCO3)CC(=O)N2 |
| InChI | InChI=1S/C17H19N3O5S/c1-4-18-17-20-16-15(26-17)9(6-11(21)19-16)8-5-10-13(25-7-24-10)14(23-3)12(8)22-2/h5,9H,4,6-7H2,1-3H3,(H,18,20)(H,19,21)/t9-/m1/s1 |
| InChIKey | NEAGTUNJGPRHGH-SECBINFHSA-N |
| XLogP | 2.79 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |