C26H23ClN4O5S — CID 5169031
3-[(4-chlorophenyl)methyl]-N-(2-methoxyethyl)-2-[(3-nitrophenyl)methylsulfanyl]-4-oxoquinazoline-7-carboxamide (PubChem CID 5169031) has the molecular formula C26H23ClN4O5S and a molecular weight of 539.01 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-N-(2-methoxyethyl)-2-[(3-nitrophenyl)methylsulfanyl]-4-oxoquinazoline-7-carboxamide.
| Compound Name | 3-[(4-chlorophenyl)methyl]-N-(2-methoxyethyl)-2-[(3-nitrophenyl)methylsulfanyl]-4-oxoquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 5169031 |
| Molecular Formula | C26H23ClN4O5S |
| Molecular Weight | 539.01 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-N-(2-methoxyethyl)-2-[(3-nitrophenyl)methylsulfanyl]-4-oxoquinazoline-7-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(=O)n(Cc3ccc(Cl)cc3)c(SCc3cccc([N+](=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C26H23ClN4O5S/c1-36-12-11-28-24(32)19-7-10-22-23(14-19)29-26(37-16-18-3-2-4-21(13-18)31(34)35)30(25(22)33)15-17-5-8-20(27)9-6-17/h2-10,13-14H,11-12,15-16H2,1H3,(H,28,32) |
| InChIKey | IAHWOCZLZXELSN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.01 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|