C19H18N6 — CID 51691471
(8R,8aS)-6-amino-2-ethyl-8-pyridin-4-yl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile (PubChem CID 51691471) has the molecular formula C19H18N6 and a molecular weight of 330.39 g/mol. Its IUPAC name is (8R,8aS)-6-amino-2-ethyl-8-pyridin-4-yl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile.
| Compound Name | (8R,8aS)-6-amino-2-ethyl-8-pyridin-4-yl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile |
|---|---|
| PubChem CID | 51691471 |
| Molecular Formula | C19H18N6 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (8R,8aS)-6-amino-2-ethyl-8-pyridin-4-yl-1,3,8,8a-tetrahydroisoquinoline-5,5,7-tricarbonitrile |
| SMILES | CCN1CC=C2[C@@H](C1)[C@H](c1ccncc1)C(C#N)=C(N)C2(C#N)C#N |
| InChI | InChI=1S/C19H18N6/c1-2-25-8-5-16-15(10-25)17(13-3-6-24-7-4-13)14(9-20)18(23)19(16,11-21)12-22/h3-7,15,17H,2,8,10,23H2,1H3/t15-,17-/m1/s1 |
| InChIKey | HJQSNRQIRXLQIX-NVXWUHKLSA-N |
| XLogP | 1.83 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|