About 1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea
1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea (PubChem CID 5169274) has the molecular formula C22H30N3O+
and a molecular weight of 352.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea |
| PubChem CID | 5169274 |
| Molecular Formula | C22H30N3O+ |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea |
| SMILES | Cc1ccc(NC(=O)N(C2CCCCC2)C(C)c2ccc[nH+]c2)cc1C |
| InChI | InChI=1S/C22H29N3O/c1-16-11-12-20(14-17(16)2)24-22(26)25(21-9-5-4-6-10-21)18(3)19-8-7-13-23-15-19/h7-8,11-15,18,21H,4-6,9-10H2,1-3H3,(H,24,26)/p+1 |
| InChIKey | QNDPGDRUZILDKB-UHFFFAOYSA-O |
| XLogP | 5.05 |
| TPSA | 46.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea?
The IUPAC name of 1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea (CID 5169274) is 1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea.
What is the SMILES notation for 1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea?
The canonical SMILES for 1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea is Cc1ccc(NC(=O)N(C2CCCCC2)C(C)c2ccc[nH+]c2)cc1C.
What is the InChIKey of 1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea?
The InChIKey is QNDPGDRUZILDKB-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H29N3O/c1-16-11-12-20(14-17(16)2)24-22(26)25(21-9-5-4-6-10-21)18(3)19-8-7-13-23-15-19/h7-8,11-15,18,21H,4-6,9-10H2,1-3H3,(H,24,26)/p+1.
What are the key properties of 1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea?
1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea has a molecular weight of 352.50 g/mol, XLogP of 5.05, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-(3,4-dimethylphenyl)-1-(1-pyridin-1-ium-3-ylethyl)urea is sourced from PubChem (CID 5169274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).