C24H34O7 — CID 51693650
2-[(2R,3S,3aR,5aR,6S,9aR,9bS)-3-acetyl-6-(carboxymethyl)-2-hydroxy-3a,5a,9b-trimethyl-5-oxo-2,3,4,6,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-7-yl]-2-methylpropanoic acid (PubChem CID 51693650) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is 2-[(2R,3S,3aR,5aR,6S,9aR,9bS)-3-acetyl-6-(carboxymethyl)-2-hydroxy-3a,5a,9b-trimethyl-5-oxo-2,3,4,6,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-7-yl]-2-methylpropanoic acid.
| Compound Name | 2-[(2R,3S,3aR,5aR,6S,9aR,9bS)-3-acetyl-6-(carboxymethyl)-2-hydroxy-3a,5a,9b-trimethyl-5-oxo-2,3,4,6,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-7-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 51693650 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 2-[(2R,3S,3aR,5aR,6S,9aR,9bS)-3-acetyl-6-(carboxymethyl)-2-hydroxy-3a,5a,9b-trimethyl-5-oxo-2,3,4,6,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-7-yl]-2-methylpropanoic acid |
| SMILES | CC(=O)[C@@H]1[C@H](O)C[C@@]2(C)[C@H]3CC=C(C(C)(C)C(=O)O)[C@H](CC(=O)O)[C@]3(C)C(=O)C[C@]12C |
| InChI | InChI=1S/C24H34O7/c1-12(25)19-15(26)10-22(4)16-8-7-13(21(2,3)20(30)31)14(9-18(28)29)24(16,6)17(27)11-23(19,22)5/h7,14-16,19,26H,8-11H2,1-6H3,(H,28,29)(H,30,31)/t14-,15+,16+,19+,22-,23+,24-/m0/s1 |
| InChIKey | KGTIDUVXRNQQQX-DWJDACHOSA-N |
| XLogP | 3.10 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|