C20H24O7 — CID 51693676
[(1R,3R,5S,9R,10R,11R)-10-hydroxy-3-methyl-8,12-dimethylidene-7,13-dioxo-4,14-dioxatricyclo[9.3.0.03,5]tetradecan-9-yl] (Z)-2-methylbut-2-enoate (PubChem CID 51693676) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is [(1R,3R,5S,9R,10R,11R)-10-hydroxy-3-methyl-8,12-dimethylidene-7,13-dioxo-4,14-dioxatricyclo[9.3.0.03,5]tetradecan-9-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,3R,5S,9R,10R,11R)-10-hydroxy-3-methyl-8,12-dimethylidene-7,13-dioxo-4,14-dioxatricyclo[9.3.0.03,5]tetradecan-9-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 51693676 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [(1R,3R,5S,9R,10R,11R)-10-hydroxy-3-methyl-8,12-dimethylidene-7,13-dioxo-4,14-dioxatricyclo[9.3.0.03,5]tetradecan-9-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@@H]2C[C@@]3(C)O[C@H]3CC(=O)C(=C)[C@@H](OC(=O)/C(C)=C\C)[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C20H24O7/c1-6-9(2)18(23)26-17-10(3)12(21)7-14-20(5,27-14)8-13-15(16(17)22)11(4)19(24)25-13/h6,13-17,22H,3-4,7-8H2,1-2,5H3/b9-6-/t13-,14+,15+,16-,17-,20-/m1/s1 |
| InChIKey | NHWGDYFJTDTLPV-OFXYGERHSA-N |
| XLogP | 1.40 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|